C16H30O2Si — CID 134870724
[(2R)-2-[(E)-but-1-enyl]-5-methyl-3,4-dihydro-2H-pyran-6-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134870724) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is [(2R)-2-[(E)-but-1-enyl]-5-methyl-3,4-dihydro-2H-pyran-6-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R)-2-[(E)-but-1-enyl]-5-methyl-3,4-dihydro-2H-pyran-6-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134870724 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | [(2R)-2-[(E)-but-1-enyl]-5-methyl-3,4-dihydro-2H-pyran-6-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC/C=C/[C@H]1CCC(C)=C(O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C16H30O2Si/c1-8-9-10-14-12-11-13(2)15(17-14)18-19(6,7)16(3,4)5/h9-10,14H,8,11-12H2,1-7H3/b10-9+/t14-/m0/s1 |
| InChIKey | VGQIOTNGPALGDH-HBWSCVEGSA-N |
| XLogP | 5.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|