C14H26O2Si — CID 135040285
[(Z)-1-[(1R)-cyclohex-2-en-1-yl]oxy-2-methylbut-1-enoxy]-trimethylsilane (PubChem CID 135040285) has the molecular formula C14H26O2Si and a molecular weight of 254.45 g/mol. Its IUPAC name is [(Z)-1-[(1R)-cyclohex-2-en-1-yl]oxy-2-methylbut-1-enoxy]-trimethylsilane.
| Compound Name | [(Z)-1-[(1R)-cyclohex-2-en-1-yl]oxy-2-methylbut-1-enoxy]-trimethylsilane |
|---|---|
| PubChem CID | 135040285 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | [(Z)-1-[(1R)-cyclohex-2-en-1-yl]oxy-2-methylbut-1-enoxy]-trimethylsilane |
| SMILES | CC/C(C)=C(/O[C@H]1C=CCCC1)O[Si](C)(C)C |
| InChI | InChI=1S/C14H26O2Si/c1-6-12(2)14(16-17(3,4)5)15-13-10-8-7-9-11-13/h8,10,13H,6-7,9,11H2,1-5H3/b14-12-/t13-/m0/s1 |
| InChIKey | MYSXYJJOSOYVNX-BSHRGCEOSA-N |
| XLogP | 4.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|