C16H28O4Si — CID 11381411
[2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate (PubChem CID 11381411) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is [2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate.
| Compound Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate |
|---|---|
| PubChem CID | 11381411 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohex-2-en-1-yl] ethenyl carbonate |
| SMILES | C=COC(=O)OC1CCCC=C1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28O4Si/c1-7-18-15(17)20-14-11-9-8-10-13(14)12-19-21(5,6)16(2,3)4/h7,10,14H,1,8-9,11-12H2,2-6H3 |
| InChIKey | BASFDOPUQFBEBP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|