C17H30O4Si — CID 99772754
[(3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate (PubChem CID 99772754) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is [(3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate.
| Compound Name | [(3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate |
|---|---|
| PubChem CID | 99772754 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [(3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohepten-1-yl] prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC1=C[C@H](O[Si](C)(C)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C17H30O4Si/c1-7-12-19-16(18)20-14-10-8-9-11-15(13-14)21-22(5,6)17(2,3)4/h7,13,15H,1,8-12H2,2-6H3/t15-/m1/s1 |
| InChIKey | HAUNCUYSJIFFDH-OAHLLOKOSA-N |
| XLogP | 5.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|