C17H32O2Si — CID 10661665
tert-butyl-dimethyl-[(1R,2S)-2-(2-methylprop-2-enoxy)cyclohept-3-en-1-yl]oxysilane (PubChem CID 10661665) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,2S)-2-(2-methylprop-2-enoxy)cyclohept-3-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R,2S)-2-(2-methylprop-2-enoxy)cyclohept-3-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 10661665 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,2S)-2-(2-methylprop-2-enoxy)cyclohept-3-en-1-yl]oxysilane |
| SMILES | C=C(C)CO[C@H]1C=CCCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-14(2)13-18-15-11-9-8-10-12-16(15)19-20(6,7)17(3,4)5/h9,11,15-16H,1,8,10,12-13H2,2-7H3/t15-,16+/m0/s1 |
| InChIKey | NCUQORLQFXHQIG-JKSUJKDBSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|