C17H34O2Si — CID 139718584
tert-butyl-[(2E,6R)-6-methoxy-3-methylnona-2,8-dienoxy]-dimethylsilane (PubChem CID 139718584) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is tert-butyl-[(2E,6R)-6-methoxy-3-methylnona-2,8-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,6R)-6-methoxy-3-methylnona-2,8-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 139718584 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | tert-butyl-[(2E,6R)-6-methoxy-3-methylnona-2,8-dienoxy]-dimethylsilane |
| SMILES | C=CC[C@@H](CC/C(C)=C/CO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C17H34O2Si/c1-9-10-16(18-6)12-11-15(2)13-14-19-20(7,8)17(3,4)5/h9,13,16H,1,10-12,14H2,2-8H3/b15-13+/t16-/m0/s1 |
| InChIKey | YFIBKXGSMBKKAM-MDJJKAFGSA-N |
| XLogP | 5.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|