C15H12ClNO — CID 134863575
5-(2-chlorophenyl)-3-phenyl-4,5-dihydro-1,2-oxazole (PubChem CID 134863575) has the molecular formula C15H12ClNO and a molecular weight of 257.72 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-3-phenyl-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-(2-chlorophenyl)-3-phenyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 134863575 |
| Molecular Formula | C15H12ClNO |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 5-(2-chlorophenyl)-3-phenyl-4,5-dihydro-1,2-oxazole |
| SMILES | Clc1ccccc1C1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C15H12ClNO/c16-13-9-5-4-8-12(13)15-10-14(17-18-15)11-6-2-1-3-7-11/h1-9,15H,10H2 |
| InChIKey | PDNKNNDYNNDUQA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |