C17H16ClNO — CID 59544929
5-benzyl-3-(4-chlorophenyl)-5-methyl-4H-1,2-oxazole (PubChem CID 59544929) has the molecular formula C17H16ClNO and a molecular weight of 285.77 g/mol. Its IUPAC name is 5-benzyl-3-(4-chlorophenyl)-5-methyl-4H-1,2-oxazole.
| Compound Name | 5-benzyl-3-(4-chlorophenyl)-5-methyl-4H-1,2-oxazole |
|---|---|
| PubChem CID | 59544929 |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 5-benzyl-3-(4-chlorophenyl)-5-methyl-4H-1,2-oxazole |
| SMILES | CC1(Cc2ccccc2)CC(c2ccc(Cl)cc2)=NO1 |
| InChI | InChI=1S/C17H16ClNO/c1-17(11-13-5-3-2-4-6-13)12-16(19-20-17)14-7-9-15(18)10-8-14/h2-10H,11-12H2,1H3 |
| InChIKey | VQZLZKMDVOHZKK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |