C19H20ClNO — CID 46881759
N-[(4-chlorophenyl)-phenylmethoxy]cyclohexanimine (PubChem CID 46881759) has the molecular formula C19H20ClNO and a molecular weight of 313.83 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-phenylmethoxy]cyclohexanimine.
| Compound Name | N-[(4-chlorophenyl)-phenylmethoxy]cyclohexanimine |
|---|---|
| PubChem CID | 46881759 |
| Molecular Formula | C19H20ClNO |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[(4-chlorophenyl)-phenylmethoxy]cyclohexanimine |
| SMILES | Clc1ccc(C(ON=C2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20ClNO/c20-17-13-11-16(12-14-17)19(15-7-3-1-4-8-15)22-21-18-9-5-2-6-10-18/h1,3-4,7-8,11-14,19H,2,5-6,9-10H2 |
| InChIKey | MJWGIJXLBVVMLT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|