C38H54O6 — CID 134864041
5-tert-butyl-1,3-bis[[5-tert-butyl-2-(methoxymethoxy)phenyl]methyl]-2-(methoxymethoxy)benzene (PubChem CID 134864041) has the molecular formula C38H54O6 and a molecular weight of 606.84 g/mol. Its IUPAC name is 5-tert-butyl-1,3-bis[[5-tert-butyl-2-(methoxymethoxy)phenyl]methyl]-2-(methoxymethoxy)benzene.
| Compound Name | 5-tert-butyl-1,3-bis[[5-tert-butyl-2-(methoxymethoxy)phenyl]methyl]-2-(methoxymethoxy)benzene |
|---|---|
| PubChem CID | 134864041 |
| Molecular Formula | C38H54O6 |
| Molecular Weight | 606.84 g/mol |
| Exact Mass | 606.39 |
| IUPAC Name | 5-tert-butyl-1,3-bis[[5-tert-butyl-2-(methoxymethoxy)phenyl]methyl]-2-(methoxymethoxy)benzene |
| SMILES | COCOc1ccc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc(Cc2cc(C(C)(C)C)ccc2OCOC)c1OCOC |
| InChI | InChI=1S/C38H54O6/c1-36(2,3)30-13-15-33(42-23-39-10)26(19-30)17-28-21-32(38(7,8)9)22-29(35(28)44-25-41-12)18-27-20-31(37(4,5)6)14-16-34(27)43-24-40-11/h13-16,19-22H,17-18,23-25H2,1-12H3 |
| InChIKey | VJLIEQZYZMYNAB-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.84 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|