C46H48O9S — CID 134864442
(6S,8aR)-7-[(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 134864442) has the molecular formula C46H48O9S and a molecular weight of 776.95 g/mol. Its IUPAC name is (6S,8aR)-7-[(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (6S,8aR)-7-[(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 134864442 |
| Molecular Formula | C46H48O9S |
| Molecular Weight | 776.95 g/mol |
| Exact Mass | 776.30 |
| IUPAC Name | (6S,8aR)-7-[(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CC1O[C@@H](OC2C(O)[C@H]3OC(c4ccccc4)OCC3O[C@H]2Sc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C46H48O9S/c1-31-39(48-27-32-17-7-2-8-18-32)42(49-28-33-19-9-3-10-20-33)43(50-29-34-21-11-4-12-22-34)45(52-31)55-41-38(47)40-37(53-46(41)56-36-25-15-6-16-26-36)30-51-44(54-40)35-23-13-5-14-24-35/h2-26,31,37-47H,27-30H2,1H3/t31?,37?,38?,39-,40+,41?,42?,43?,44?,45+,46+/m1/s1 |
| InChIKey | QFVXCVSKWJEZFL-DSRVBUSFSA-N |
| XLogP | 7.86 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.95 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |