C19H28O3 — CID 134864476
ethyl (2E,4E,6E)-3,7-dimethyl-8-(1-methyl-2-oxocyclohexyl)octa-2,4,6-trienoate (PubChem CID 134864476) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is ethyl (2E,4E,6E)-3,7-dimethyl-8-(1-methyl-2-oxocyclohexyl)octa-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6E)-3,7-dimethyl-8-(1-methyl-2-oxocyclohexyl)octa-2,4,6-trienoate |
|---|---|
| PubChem CID | 134864476 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | ethyl (2E,4E,6E)-3,7-dimethyl-8-(1-methyl-2-oxocyclohexyl)octa-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C=C(\C)CC1(C)CCCCC1=O |
| InChI | InChI=1S/C19H28O3/c1-5-22-18(21)13-15(2)9-8-10-16(3)14-19(4)12-7-6-11-17(19)20/h8-10,13H,5-7,11-12,14H2,1-4H3/b9-8+,15-13+,16-10+ |
| InChIKey | NDFNVWVPLOFTTD-KWSORBODSA-N |
| XLogP | 4.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|