C17H24O6 — CID 134864656
[(1S,2R,6R,7S,8R,9S)-7,8-dimethoxy-5,9-dimethyl-12-oxo-10-oxatricyclo[7.2.1.01,6]dodec-4-en-2-yl] acetate (PubChem CID 134864656) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is [(1S,2R,6R,7S,8R,9S)-7,8-dimethoxy-5,9-dimethyl-12-oxo-10-oxatricyclo[7.2.1.01,6]dodec-4-en-2-yl] acetate.
| Compound Name | [(1S,2R,6R,7S,8R,9S)-7,8-dimethoxy-5,9-dimethyl-12-oxo-10-oxatricyclo[7.2.1.01,6]dodec-4-en-2-yl] acetate |
|---|---|
| PubChem CID | 134864656 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [(1S,2R,6R,7S,8R,9S)-7,8-dimethoxy-5,9-dimethyl-12-oxo-10-oxatricyclo[7.2.1.01,6]dodec-4-en-2-yl] acetate |
| SMILES | CO[C@@H]1[C@@H](OC)[C@]2(C)OC[C@]3(C2=O)[C@H](OC(C)=O)CC=C(C)[C@@H]13 |
| InChI | InChI=1S/C17H24O6/c1-9-6-7-11(23-10(2)18)17-8-22-16(3,15(17)19)14(21-5)13(20-4)12(9)17/h6,11-14H,7-8H2,1-5H3/t11-,12+,13+,14-,16+,17+/m1/s1 |
| InChIKey | DPXQNTKFKSVDEQ-FKKJATDVSA-N |
| XLogP | 1.27 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|