C32H56O6Si2 — CID 101384355
[(1R,2S,9S,10R,11R,12S,13R)-11,12-bis[[tert-butyl(dimethyl)silyl]oxy]-5,9,13-trimethyl-16-oxo-14-oxatetracyclo[11.2.1.01,10.04,9]hexadec-5-en-2-yl] acetate (PubChem CID 101384355) has the molecular formula C32H56O6Si2 and a molecular weight of 592.97 g/mol. Its IUPAC name is [(1R,2S,9S,10R,11R,12S,13R)-11,12-bis[[tert-butyl(dimethyl)silyl]oxy]-5,9,13-trimethyl-16-oxo-14-oxatetracyclo[11.2.1.01,10.04,9]hexadec-5-en-2-yl] acetate.
| Compound Name | [(1R,2S,9S,10R,11R,12S,13R)-11,12-bis[[tert-butyl(dimethyl)silyl]oxy]-5,9,13-trimethyl-16-oxo-14-oxatetracyclo[11.2.1.01,10.04,9]hexadec-5-en-2-yl] acetate |
|---|---|
| PubChem CID | 101384355 |
| Molecular Formula | C32H56O6Si2 |
| Molecular Weight | 592.97 g/mol |
| Exact Mass | 592.36 |
| IUPAC Name | [(1R,2S,9S,10R,11R,12S,13R)-11,12-bis[[tert-butyl(dimethyl)silyl]oxy]-5,9,13-trimethyl-16-oxo-14-oxatetracyclo[11.2.1.01,10.04,9]hexadec-5-en-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC2C(C)=CCC[C@]2(C)[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@]3(C)OC[C@@]12C3=O |
| InChI | InChI=1S/C32H56O6Si2/c1-20-16-15-17-30(9)22(20)18-23(36-21(2)33)32-19-35-31(10,27(32)34)26(38-40(13,14)29(6,7)8)24(25(30)32)37-39(11,12)28(3,4)5/h16,22-26H,15,17-19H2,1-14H3/t22?,23-,24+,25+,26-,30-,31+,32+/m0/s1 |
| InChIKey | TWENDLPZHXNPQP-CCKMTZCFSA-N |
| XLogP | 7.44 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.97 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|