C20H33N2P — CID 134865095
5-benzyl-N,N-di(propan-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-phospholo[3,4-c]pyridin-2-amine (PubChem CID 134865095) has the molecular formula C20H33N2P and a molecular weight of 332.47 g/mol. Its IUPAC name is 5-benzyl-N,N-di(propan-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-phospholo[3,4-c]pyridin-2-amine.
| Compound Name | 5-benzyl-N,N-di(propan-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-phospholo[3,4-c]pyridin-2-amine |
|---|---|
| PubChem CID | 134865095 |
| Molecular Formula | C20H33N2P |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 5-benzyl-N,N-di(propan-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-phospholo[3,4-c]pyridin-2-amine |
| SMILES | CC(C)N(C(C)C)P1CC2CCN(Cc3ccccc3)CC2C1 |
| InChI | InChI=1S/C20H33N2P/c1-16(2)22(17(3)4)23-14-19-10-11-21(13-20(19)15-23)12-18-8-6-5-7-9-18/h5-9,16-17,19-20H,10-15H2,1-4H3 |
| InChIKey | LVMJVDOCRRGSCQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|