C13H16BrNO2 — CID 134865270
(2R)-3-(3-bromoindol-1-yl)-3-methylbutane-1,2-diol (PubChem CID 134865270) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is (2R)-3-(3-bromoindol-1-yl)-3-methylbutane-1,2-diol.
| Compound Name | (2R)-3-(3-bromoindol-1-yl)-3-methylbutane-1,2-diol |
|---|---|
| PubChem CID | 134865270 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | (2R)-3-(3-bromoindol-1-yl)-3-methylbutane-1,2-diol |
| SMILES | CC(C)([C@@H](O)CO)n1cc(Br)c2ccccc21 |
| InChI | InChI=1S/C13H16BrNO2/c1-13(2,12(17)8-16)15-7-10(14)9-5-3-4-6-11(9)15/h3-7,12,16-17H,8H2,1-2H3/t12-/m0/s1 |
| InChIKey | NPZSPYMZRXFYCY-LBPRGKRZSA-N |
| XLogP | 2.49 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |