C20H29F3NO7P — CID 134865321
(1-diethoxyphosphoryl-2,2,2-trifluoroethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (PubChem CID 134865321) has the molecular formula C20H29F3NO7P and a molecular weight of 483.42 g/mol. Its IUPAC name is (1-diethoxyphosphoryl-2,2,2-trifluoroethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate.
| Compound Name | (1-diethoxyphosphoryl-2,2,2-trifluoroethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 134865321 |
| Molecular Formula | C20H29F3NO7P |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | (1-diethoxyphosphoryl-2,2,2-trifluoroethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| SMILES | CCOP(=O)(OCC)C(OC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C20H29F3NO7P/c1-6-28-32(27,29-7-2)17(20(21,22)23)30-16(25)15(13-14-11-9-8-10-12-14)24-18(26)31-19(3,4)5/h8-12,15,17H,6-7,13H2,1-5H3,(H,24,26)/t15-,17?/m0/s1 |
| InChIKey | VBGOVRHLNGWNJD-MYJWUSKBSA-N |
| XLogP | 4.82 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|