About CID 134865379
CID 134865379 (PubChem CID 134865379) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol.
Molecular Properties
| Compound Name | CID 134865379 |
| PubChem CID | 134865379 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | — |
| SMILES | CCOC(=O)[C]C[C@@]1(C)CCCC(=O)C1 |
| InChI | InChI=1S/C12H18O3/c1-3-15-11(14)6-8-12(2)7-4-5-10(13)9-12/h3-5,7-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | DLXVAQKPXHECMC-GFCCVEGCSA-N |
| XLogP | 2.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 134865379 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134865379?
The IUPAC name of CID 134865379 (CID 134865379) is not available.
What is the SMILES notation for CID 134865379?
The canonical SMILES for CID 134865379 is CCOC(=O)[C]C[C@@]1(C)CCCC(=O)C1.
What is the InChIKey of CID 134865379?
The InChIKey is DLXVAQKPXHECMC-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H18O3/c1-3-15-11(14)6-8-12(2)7-4-5-10(13)9-12/h3-5,7-9H2,1-2H3/t12-/m1/s1.
What are the key properties of CID 134865379?
CID 134865379 has a molecular weight of 210.27 g/mol, XLogP of 2.17, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134865379 is sourced from PubChem (CID 134865379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).