About (3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one
(3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one (PubChem CID 159087738) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is (3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | (3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one |
| PubChem CID | 159087738 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)CCC1.CC[C@]1(C)CCCC(=O)C1 |
| InChI | InChI=1S/C9H16O.C7H10O/c1-3-9(2)6-4-5-8(10)7-9;1-6-3-2-4-7(8)5-6/h3-7H2,1-2H3;5H,2-4H2,1H3/t9-;/m1./s1 |
| InChIKey | KBQSOCMTKQEOHB-SBSPUUFOSA-N |
| XLogP | 4.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one?
The IUPAC name of (3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one (CID 159087738) is (3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one.
What is the SMILES notation for (3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one?
The canonical SMILES for (3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one is CC1=CC(=O)CCC1.CC[C@]1(C)CCCC(=O)C1.
What is the InChIKey of (3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one?
The InChIKey is KBQSOCMTKQEOHB-SBSPUUFOSA-N. The full InChI is InChI=1S/C9H16O.C7H10O/c1-3-9(2)6-4-5-8(10)7-9;1-6-3-2-4-7(8)5-6/h3-7H2,1-2H3;5H,2-4H2,1H3/t9-;/m1./s1.
What are the key properties of (3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one?
(3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one has a molecular weight of 250.38 g/mol, XLogP of 4.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-ethyl-3-methylcyclohexan-1-one;3-methylcyclohex-2-en-1-one is sourced from PubChem (CID 159087738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).