C39H45NO5Si — CID 134865641
(4S)-4-benzyl-3-[(2S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(S)-hydroxy(phenyl)methyl]hexanoyl]-1,3-oxazolidin-2-one (PubChem CID 134865641) has the molecular formula C39H45NO5Si and a molecular weight of 635.88 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(S)-hydroxy(phenyl)methyl]hexanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(S)-hydroxy(phenyl)methyl]hexanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134865641 |
| Molecular Formula | C39H45NO5Si |
| Molecular Weight | 635.88 g/mol |
| Exact Mass | 635.31 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(S)-hydroxy(phenyl)methyl]hexanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](OCCCC[C@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@H](O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H45NO5Si/c1-39(2,3)46(33-22-12-6-13-23-33,34-24-14-7-15-25-34)45-27-17-16-26-35(36(41)31-20-10-5-11-21-31)37(42)40-32(29-44-38(40)43)28-30-18-8-4-9-19-30/h4-15,18-25,32,35-36,41H,16-17,26-29H2,1-3H3/t32-,35-,36+/m0/s1 |
| InChIKey | OKEHMEVATZIVOI-AOAHCQAQSA-N |
| XLogP | 6.67 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.88 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|