C21H25NO5 — CID 134865924
(NE)-N-[(2R,3S,5S)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxan-4-ylidene]hydroxylamine (PubChem CID 134865924) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is (NE)-N-[(2R,3S,5S)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxan-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2R,3S,5S)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxan-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 134865924 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (NE)-N-[(2R,3S,5S)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxan-4-ylidene]hydroxylamine |
| SMILES | CO[C@@H]1OC(C)[C@@H](OCc2ccccc2)/C(=N\O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H25NO5/c1-15-19(25-13-16-9-5-3-6-10-16)18(22-23)20(21(24-2)27-15)26-14-17-11-7-4-8-12-17/h3-12,15,19-21,23H,13-14H2,1-2H3/b22-18+/t15?,19-,20+,21-/m1/s1 |
| InChIKey | VZSKFCQCMVYCHZ-CPSNZDJDSA-N |
| XLogP | 3.38 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|