C23H31NO4 — CID 134865967
(2R,5S)-2-methoxy-N,N,6-trimethyl-3,5-bis(phenylmethoxy)oxan-4-amine (PubChem CID 134865967) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is (2R,5S)-2-methoxy-N,N,6-trimethyl-3,5-bis(phenylmethoxy)oxan-4-amine.
| Compound Name | (2R,5S)-2-methoxy-N,N,6-trimethyl-3,5-bis(phenylmethoxy)oxan-4-amine |
|---|---|
| PubChem CID | 134865967 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (2R,5S)-2-methoxy-N,N,6-trimethyl-3,5-bis(phenylmethoxy)oxan-4-amine |
| SMILES | CO[C@@H]1OC(C)[C@@H](OCc2ccccc2)C(N(C)C)C1OCc1ccccc1 |
| InChI | InChI=1S/C23H31NO4/c1-17-21(26-15-18-11-7-5-8-12-18)20(24(2)3)22(23(25-4)28-17)27-16-19-13-9-6-10-14-19/h5-14,17,20-23H,15-16H2,1-4H3/t17?,20?,21-,22?,23-/m1/s1 |
| InChIKey | GGONGSVOSXTCPB-RTWMTPCASA-N |
| XLogP | 3.48 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |