C21H25NO3 — CID 90667071
(2S,4R)-2-[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]-4-methoxypiperidine (PubChem CID 90667071) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (2S,4R)-2-[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]-4-methoxypiperidine.
| Compound Name | (2S,4R)-2-[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]-4-methoxypiperidine |
|---|---|
| PubChem CID | 90667071 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2S,4R)-2-[(4R)-2,2-diphenyl-1,3-dioxolan-4-yl]-4-methoxypiperidine |
| SMILES | CO[C@@H]1CCN[C@H]([C@@H]2COC(c3ccccc3)(c3ccccc3)O2)C1 |
| InChI | InChI=1S/C21H25NO3/c1-23-18-12-13-22-19(14-18)20-15-24-21(25-20,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18-20,22H,12-15H2,1H3/t18-,19+,20+/m1/s1 |
| InChIKey | OTWLVLZKOFMBLI-AABGKKOBSA-N |
| XLogP | 3.07 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |