C18H31NO4 — CID 134866004
ethyl 2-[[(2-methylpropan-2-yl)oxycarbonyl-pent-3-enylamino]methyl]pent-4-enoate (PubChem CID 134866004) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is ethyl 2-[[(2-methylpropan-2-yl)oxycarbonyl-pent-3-enylamino]methyl]pent-4-enoate.
| Compound Name | ethyl 2-[[(2-methylpropan-2-yl)oxycarbonyl-pent-3-enylamino]methyl]pent-4-enoate |
|---|---|
| PubChem CID | 134866004 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | ethyl 2-[[(2-methylpropan-2-yl)oxycarbonyl-pent-3-enylamino]methyl]pent-4-enoate |
| SMILES | C=CCC(CN(CCC=CC)C(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C18H31NO4/c1-7-10-11-13-19(17(21)23-18(4,5)6)14-15(12-8-2)16(20)22-9-3/h7-8,10,15H,2,9,11-14H2,1,3-6H3 |
| InChIKey | RVZSMXNSAWUGAO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|