C16H19NO4 — CID 134866635
(1S,5R,8S)-2-benzyl-6,6-dimethyl-9-oxo-3,7-dioxa-2-azabicyclo[3.3.1]nonane-8-carbaldehyde (PubChem CID 134866635) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (1S,5R,8S)-2-benzyl-6,6-dimethyl-9-oxo-3,7-dioxa-2-azabicyclo[3.3.1]nonane-8-carbaldehyde.
| Compound Name | (1S,5R,8S)-2-benzyl-6,6-dimethyl-9-oxo-3,7-dioxa-2-azabicyclo[3.3.1]nonane-8-carbaldehyde |
|---|---|
| PubChem CID | 134866635 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (1S,5R,8S)-2-benzyl-6,6-dimethyl-9-oxo-3,7-dioxa-2-azabicyclo[3.3.1]nonane-8-carbaldehyde |
| SMILES | CC1(C)O[C@H](C=O)[C@H]2C(=O)[C@@H]1CON2Cc1ccccc1 |
| InChI | InChI=1S/C16H19NO4/c1-16(2)12-10-20-17(8-11-6-4-3-5-7-11)14(15(12)19)13(9-18)21-16/h3-7,9,12-14H,8,10H2,1-2H3/t12-,13+,14-/m0/s1 |
| InChIKey | AHTPQEPGGWYMBG-MJBXVCDLSA-N |
| XLogP | 1.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|