C20H18NS- — CID 134867271
N-[(1S)-2-cyclopenta-1,3-dien-1-ylsulfanyl-1-phenylethyl]-1-phenylmethanimine (PubChem CID 134867271) has the molecular formula C20H18NS- and a molecular weight of 304.44 g/mol. Its IUPAC name is N-[(1S)-2-cyclopenta-1,3-dien-1-ylsulfanyl-1-phenylethyl]-1-phenylmethanimine.
| Compound Name | N-[(1S)-2-cyclopenta-1,3-dien-1-ylsulfanyl-1-phenylethyl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 134867271 |
| Molecular Formula | C20H18NS- |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[(1S)-2-cyclopenta-1,3-dien-1-ylsulfanyl-1-phenylethyl]-1-phenylmethanimine |
| SMILES | C(=N/[C@H](CSc1ccc[cH-]1)c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C20H18NS/c1-3-9-17(10-4-1)15-21-20(18-11-5-2-6-12-18)16-22-19-13-7-8-14-19/h1-15,20H,16H2/q-1/b21-15+/t20-/m1/s1 |
| InChIKey | GVYPUOITUPNOPZ-LNKKFFRNSA-N |
| XLogP | 5.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|