C25H27CrNO5 — CID 134867539
(1-benzyl-2,5-dibutyl-4-pyridinylidene)chromium;carbon monoxide (PubChem CID 134867539) has the molecular formula C25H27CrNO5 and a molecular weight of 473.49 g/mol. Its IUPAC name is (1-benzyl-2,5-dibutyl-4-pyridinylidene)chromium;carbon monoxide.
| Compound Name | (1-benzyl-2,5-dibutyl-4-pyridinylidene)chromium;carbon monoxide |
|---|---|
| PubChem CID | 134867539 |
| Molecular Formula | C25H27CrNO5 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | (1-benzyl-2,5-dibutyl-4-pyridinylidene)chromium;carbon monoxide |
| SMILES | CCCCc1cn(Cc2ccccc2)c(CCCC)cc1=[Cr].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C20H27N.5CO.Cr/c1-3-5-10-19-14-15-20(13-6-4-2)21(17-19)16-18-11-8-7-9-12-18;5*1-2;/h7-9,11-12,15,17H,3-6,10,13,16H2,1-2H3;;;;;; |
| InChIKey | VBCGOFAEWUHQEZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 104.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|