C18H15NO9 — CID 134867651
2-[(5-hydroxy-3-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]propanedioic acid (PubChem CID 134867651) has the molecular formula C18H15NO9 and a molecular weight of 389.32 g/mol. Its IUPAC name is 2-[(5-hydroxy-3-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]propanedioic acid.
| Compound Name | 2-[(5-hydroxy-3-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]propanedioic acid |
|---|---|
| PubChem CID | 134867651 |
| Molecular Formula | C18H15NO9 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-[(5-hydroxy-3-methoxy-2-nitro-4-phenylmethoxyphenyl)methylidene]propanedioic acid |
| SMILES | COc1c(OCc2ccccc2)c(O)cc(C=C(C(=O)O)C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15NO9/c1-27-16-14(19(25)26)11(7-12(17(21)22)18(23)24)8-13(20)15(16)28-9-10-5-3-2-4-6-10/h2-8,20H,9H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | FBBYJMLOKNGSHT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|