C13H19ClN2O6S — CID 134868363
[(Z)-2-(benzenesulfonyl)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate (PubChem CID 134868363) has the molecular formula C13H19ClN2O6S and a molecular weight of 366.82 g/mol. Its IUPAC name is [(Z)-2-(benzenesulfonyl)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate.
| Compound Name | [(Z)-2-(benzenesulfonyl)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate |
|---|---|
| PubChem CID | 134868363 |
| Molecular Formula | C13H19ClN2O6S |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [(Z)-2-(benzenesulfonyl)-3-(dimethylamino)prop-2-enylidene]-dimethylazanium perchlorate |
| SMILES | CN(C)/C=C(/C=[N+](C)C)S(=O)(=O)c1ccccc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C13H19N2O2S.ClHO4/c1-14(2)10-13(11-15(3)4)18(16,17)12-8-6-5-7-9-12;2-1(3,4)5/h5-11H,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | GQDNXVUHKLQRTR-UHFFFAOYSA-M |
| XLogP | -3.55 |
| TPSA | 132.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|