C9H14O4 — CID 134868498
3,4,5-trimethoxycyclohex-2-en-1-one (PubChem CID 134868498) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 3,4,5-trimethoxycyclohex-2-en-1-one.
| Compound Name | 3,4,5-trimethoxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 134868498 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 3,4,5-trimethoxycyclohex-2-en-1-one |
| SMILES | COC1=CC(=O)CC(OC)C1OC |
| InChI | InChI=1S/C9H14O4/c1-11-7-4-6(10)5-8(12-2)9(7)13-3/h4,8-9H,5H2,1-3H3 |
| InChIKey | YCJKSQNTBJTKNZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |