C12H18O5 — CID 11075621
1-(4,5,5,6-tetramethoxycyclohexa-1,3-dien-1-yl)ethanone (PubChem CID 11075621) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-(4,5,5,6-tetramethoxycyclohexa-1,3-dien-1-yl)ethanone.
| Compound Name | 1-(4,5,5,6-tetramethoxycyclohexa-1,3-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 11075621 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-(4,5,5,6-tetramethoxycyclohexa-1,3-dien-1-yl)ethanone |
| SMILES | COC1=CC=C(C(C)=O)C(OC)C1(OC)OC |
| InChI | InChI=1S/C12H18O5/c1-8(13)9-6-7-10(14-2)12(16-4,17-5)11(9)15-3/h6-7,11H,1-5H3 |
| InChIKey | YJWCFKOEDZQYCL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|