About 2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide
2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide (PubChem CID 134868727) has the molecular formula C28H26BrN2OP
and a molecular weight of 517.41 g/mol. Its IUPAC name is 2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide.
Molecular Properties
| Compound Name | 2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide |
| PubChem CID | 134868727 |
| Molecular Formula | C28H26BrN2OP |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide |
| SMILES | C/C(=C\P(Br)(c1ccccc1)(c1ccccc1)c1ccccc1)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C28H26BrN2OP/c1-22(31-27-20-12-11-19-26(27)28(30)32)21-33(29,23-13-5-2-6-14-23,24-15-7-3-8-16-24)25-17-9-4-10-18-25/h2-21,31H,1H3,(H2,30,32)/b22-21+ |
| InChIKey | GWHQGHOPAGMEPY-QURGRASLSA-N |
| XLogP | 5.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide?
The IUPAC name of 2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide (CID 134868727) is 2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide.
What is the SMILES notation for 2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide?
The canonical SMILES for 2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide is C/C(=C\P(Br)(c1ccccc1)(c1ccccc1)c1ccccc1)Nc1ccccc1C(N)=O.
What is the InChIKey of 2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide?
The InChIKey is GWHQGHOPAGMEPY-QURGRASLSA-N. The full InChI is InChI=1S/C28H26BrN2OP/c1-22(31-27-20-12-11-19-26(27)28(30)32)21-33(29,23-13-5-2-6-14-23,24-15-7-3-8-16-24)25-17-9-4-10-18-25/h2-21,31H,1H3,(H2,30,32)/b22-21+.
What are the key properties of 2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide?
2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide has a molecular weight of 517.41 g/mol, XLogP of 5.90, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E)-1-[bromo(triphenyl)-λ5-phosphanyl]prop-1-en-2-yl]amino]benzamide is sourced from PubChem (CID 134868727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).