2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid

C11H18O6 — CID 134868896

IUPAC2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid
SMILESCCOC(=O)C(O)(CC(=O)C(C)(C)C)C(=O)O
InChIInChI=1S/C11H18O6/c1-5-17-9(15)11(16,8(13)14)6-7(12)10(2,3)4/h16H,5-6H2,1-4H3,(H,13,14)
InChIKeyCHGIXWSDHSBYOE-UHFFFAOYSA-N
MW246.26 g/mol
LogP0.37
Rot. Bonds5

About 2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid

2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid (PubChem CID 134868896) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid.

Molecular Properties

Compound Name2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid
PubChem CID134868896
Molecular FormulaC11H18O6
Molecular Weight246.26 g/mol
Exact Mass246.11
IUPAC Name2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid
SMILESCCOC(=O)C(O)(CC(=O)C(C)(C)C)C(=O)O
InChIInChI=1S/C11H18O6/c1-5-17-9(15)11(16,8(13)14)6-7(12)10(2,3)4/h16H,5-6H2,1-4H3,(H,13,14)
InChIKeyCHGIXWSDHSBYOE-UHFFFAOYSA-N
XLogP0.37
TPSA100.90 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.26
LogP ≤ 50.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid?
The IUPAC name of 2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid (CID 134868896) is 2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid.
What is the SMILES notation for 2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid?
The canonical SMILES for 2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid is CCOC(=O)C(O)(CC(=O)C(C)(C)C)C(=O)O.
What is the InChIKey of 2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid?
The InChIKey is CHGIXWSDHSBYOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O6/c1-5-17-9(15)11(16,8(13)14)6-7(12)10(2,3)4/h16H,5-6H2,1-4H3,(H,13,14).
What are the key properties of 2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid?
2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid has a molecular weight of 246.26 g/mol, XLogP of 0.37, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid is sourced from PubChem (CID 134868896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).