C11H18O6 — CID 134868896
2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid (PubChem CID 134868896) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid.
| Compound Name | 2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid |
|---|---|
| PubChem CID | 134868896 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-ethoxycarbonyl-2-hydroxy-5,5-dimethyl-4-oxohexanoic acid |
| SMILES | CCOC(=O)C(O)(CC(=O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C11H18O6/c1-5-17-9(15)11(16,8(13)14)6-7(12)10(2,3)4/h16H,5-6H2,1-4H3,(H,13,14) |
| InChIKey | CHGIXWSDHSBYOE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|