C10H13F3O6 — CID 174437324
diethyl 2-hydroxy-2-(3,3,3-trifluoro-2-oxopropyl)propanedioate (PubChem CID 174437324) has the molecular formula C10H13F3O6 and a molecular weight of 286.20 g/mol. Its IUPAC name is diethyl 2-hydroxy-2-(3,3,3-trifluoro-2-oxopropyl)propanedioate.
| Compound Name | diethyl 2-hydroxy-2-(3,3,3-trifluoro-2-oxopropyl)propanedioate |
|---|---|
| PubChem CID | 174437324 |
| Molecular Formula | C10H13F3O6 |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | diethyl 2-hydroxy-2-(3,3,3-trifluoro-2-oxopropyl)propanedioate |
| SMILES | CCOC(=O)C(O)(CC(=O)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C10H13F3O6/c1-3-18-7(15)9(17,8(16)19-4-2)5-6(14)10(11,12)13/h17H,3-5H2,1-2H3 |
| InChIKey | YYHDTQIGQFSFAB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|