C13H22N2O2 — CID 134870572
(3Z,6S)-3-(3-methylbutylidene)-6-(2-methylpropyl)piperazine-2,5-dione (PubChem CID 134870572) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (3Z,6S)-3-(3-methylbutylidene)-6-(2-methylpropyl)piperazine-2,5-dione.
| Compound Name | (3Z,6S)-3-(3-methylbutylidene)-6-(2-methylpropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 134870572 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | (3Z,6S)-3-(3-methylbutylidene)-6-(2-methylpropyl)piperazine-2,5-dione |
| SMILES | CC(C)C/C=C1\NC(=O)[C@H](CC(C)C)NC1=O |
| InChI | InChI=1S/C13H22N2O2/c1-8(2)5-6-10-12(16)15-11(7-9(3)4)13(17)14-10/h6,8-9,11H,5,7H2,1-4H3,(H,14,17)(H,15,16)/b10-6-/t11-/m0/s1 |
| InChIKey | YPZHLNXOCSYKGW-YAEJEKNGSA-N |
| XLogP | 1.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|