C14H22N2O2 — CID 139589682
(2E,4E)-7-methyl-N-[(3S)-2-oxopiperidin-3-yl]octa-2,4-dienamide (PubChem CID 139589682) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2E,4E)-7-methyl-N-[(3S)-2-oxopiperidin-3-yl]octa-2,4-dienamide.
| Compound Name | (2E,4E)-7-methyl-N-[(3S)-2-oxopiperidin-3-yl]octa-2,4-dienamide |
|---|---|
| PubChem CID | 139589682 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (2E,4E)-7-methyl-N-[(3S)-2-oxopiperidin-3-yl]octa-2,4-dienamide |
| SMILES | CC(C)C/C=C/C=C/C(=O)N[C@H]1CCCNC1=O |
| InChI | InChI=1S/C14H22N2O2/c1-11(2)7-4-3-5-9-13(17)16-12-8-6-10-15-14(12)18/h3-5,9,11-12H,6-8,10H2,1-2H3,(H,15,18)(H,16,17)/b4-3+,9-5+/t12-/m0/s1 |
| InChIKey | GBPBWMOXNYOSIK-NFUAJREHSA-N |
| XLogP | 1.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|