C13H17FN2O3 — CID 166077343
(E)-N-(2,6-dioxopiperidin-3-yl)-2-(2-fluoroprop-1-enyl)pent-2-enamide (PubChem CID 166077343) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is (E)-N-(2,6-dioxopiperidin-3-yl)-2-(2-fluoroprop-1-enyl)pent-2-enamide.
| Compound Name | (E)-N-(2,6-dioxopiperidin-3-yl)-2-(2-fluoroprop-1-enyl)pent-2-enamide |
|---|---|
| PubChem CID | 166077343 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (E)-N-(2,6-dioxopiperidin-3-yl)-2-(2-fluoroprop-1-enyl)pent-2-enamide |
| SMILES | CC/C=C(\C=C(C)F)C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H17FN2O3/c1-3-4-9(7-8(2)14)12(18)15-10-5-6-11(17)16-13(10)19/h4,7,10H,3,5-6H2,1-2H3,(H,15,18)(H,16,17,19)/b8-7?,9-4+ |
| InChIKey | ZQQBQTGTFPARCS-RUSQRLDKSA-N |
| XLogP | 1.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|