C12H13FN2O3 — CID 165137180
N-(2,6-dioxopiperidin-3-yl)-3-fluorocyclohexa-1,5-diene-1-carboxamide (PubChem CID 165137180) has the molecular formula C12H13FN2O3 and a molecular weight of 252.24 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-3-fluorocyclohexa-1,5-diene-1-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-3-fluorocyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 165137180 |
| Molecular Formula | C12H13FN2O3 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-3-fluorocyclohexa-1,5-diene-1-carboxamide |
| SMILES | O=C1CCC(NC(=O)C2=CC(F)CC=C2)C(=O)N1 |
| InChI | InChI=1S/C12H13FN2O3/c13-8-3-1-2-7(6-8)11(17)14-9-4-5-10(16)15-12(9)18/h1-2,6,8-9H,3-5H2,(H,14,17)(H,15,16,18) |
| InChIKey | WCIQJZWBGKKJIB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|