C14H17FN2O3 — CID 156866620
N-(2,6-dioxopiperidin-3-yl)-3-fluoro-4-methylcyclohepta-1,6-diene-1-carboxamide (PubChem CID 156866620) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-3-fluoro-4-methylcyclohepta-1,6-diene-1-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-3-fluoro-4-methylcyclohepta-1,6-diene-1-carboxamide |
|---|---|
| PubChem CID | 156866620 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-3-fluoro-4-methylcyclohepta-1,6-diene-1-carboxamide |
| SMILES | CC1CC=CC(C(=O)NC2CCC(=O)NC2=O)=CC1F |
| InChI | InChI=1S/C14H17FN2O3/c1-8-3-2-4-9(7-10(8)15)13(19)16-11-5-6-12(18)17-14(11)20/h2,4,7-8,10-11H,3,5-6H2,1H3,(H,16,19)(H,17,18,20) |
| InChIKey | DNWJQRACOANIEK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|