C17H24Cl3NO6 — CID 134870765
[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-[(E)-prop-1-enyl]-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl] 2,2,2-trichloroethanimidate (PubChem CID 134870765) has the molecular formula C17H24Cl3NO6 and a molecular weight of 444.74 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-[(E)-prop-1-enyl]-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-[(E)-prop-1-enyl]-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 134870765 |
| Molecular Formula | C17H24Cl3NO6 |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-[(E)-prop-1-enyl]-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\O[C@@]1(/C=C/C)[C@@H]([C@H]2COC(C)(C)O2)O[C@@H]2OC(C)(C)O[C@@H]21)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H24Cl3NO6/c1-6-7-16(27-13(21)17(18,19)20)10(9-8-22-14(2,3)24-9)23-12-11(16)25-15(4,5)26-12/h6-7,9-12,21H,8H2,1-5H3/b7-6+,21-13-/t9-,10-,11+,12-,16+/m1/s1 |
| InChIKey | QWMSBEHUMQZKJP-YQVVIXMGSA-N |
| XLogP | 3.69 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|