C14H9BrClN3O2S — CID 134871207
(NZ,1Z)-1-(4-chlorophenyl)sulfanyl-N-[(4-nitrophenyl)methylidene]methanehydrazonoyl bromide (PubChem CID 134871207) has the molecular formula C14H9BrClN3O2S and a molecular weight of 398.67 g/mol. Its IUPAC name is (NZ,1Z)-1-(4-chlorophenyl)sulfanyl-N-[(4-nitrophenyl)methylidene]methanehydrazonoyl bromide.
| Compound Name | (NZ,1Z)-1-(4-chlorophenyl)sulfanyl-N-[(4-nitrophenyl)methylidene]methanehydrazonoyl bromide |
|---|---|
| PubChem CID | 134871207 |
| Molecular Formula | C14H9BrClN3O2S |
| Molecular Weight | 398.67 g/mol |
| Exact Mass | 396.93 |
| IUPAC Name | (NZ,1Z)-1-(4-chlorophenyl)sulfanyl-N-[(4-nitrophenyl)methylidene]methanehydrazonoyl bromide |
| SMILES | O=[N+]([O-])c1ccc(/C=N\N=C(/Br)Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H9BrClN3O2S/c15-14(22-13-7-3-11(16)4-8-13)18-17-9-10-1-5-12(6-2-10)19(20)21/h1-9H/b17-9-,18-14+ |
| InChIKey | JCPYUOJGWJIJML-HJMXTJEFSA-N |
| XLogP | 5.13 |
| TPSA | 67.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.67 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|