C41H43LiN4O — CID 134871564
lithium [3-[[5,6-bis(3,3-dimethylbut-1-ynyl)-3-methoxyisoindol-1-ylidene]amino]-5,6-bis(3,3-dimethylbut-1-ynyl)isoindol-1-ylidene]azanide (PubChem CID 134871564) has the molecular formula C41H43LiN4O and a molecular weight of 614.76 g/mol. Its IUPAC name is lithium [3-[[5,6-bis(3,3-dimethylbut-1-ynyl)-3-methoxyisoindol-1-ylidene]amino]-5,6-bis(3,3-dimethylbut-1-ynyl)isoindol-1-ylidene]azanide.
| Compound Name | lithium [3-[[5,6-bis(3,3-dimethylbut-1-ynyl)-3-methoxyisoindol-1-ylidene]amino]-5,6-bis(3,3-dimethylbut-1-ynyl)isoindol-1-ylidene]azanide |
|---|---|
| PubChem CID | 134871564 |
| Molecular Formula | C41H43LiN4O |
| Molecular Weight | 614.76 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | lithium [3-[[5,6-bis(3,3-dimethylbut-1-ynyl)-3-methoxyisoindol-1-ylidene]amino]-5,6-bis(3,3-dimethylbut-1-ynyl)isoindol-1-ylidene]azanide |
| SMILES | COC1=N/C(=N\C2=NC(=[N-])c3cc(C#CC(C)(C)C)c(C#CC(C)(C)C)cc32)c2cc(C#CC(C)(C)C)c(C#CC(C)(C)C)cc21.[Li+] |
| InChI | InChI=1S/C41H43N4O.Li/c1-38(2,3)18-14-26-22-30-31(23-27(26)15-19-39(4,5)6)35(43-34(30)42)44-36-32-24-28(16-20-40(7,8)9)29(17-21-41(10,11)12)25-33(32)37(45-36)46-13;/h22-25H,1-13H3;/q-1;+1/b44-36-; |
| InChIKey | CDGWUQCEIHBWAT-RWUPSKCGSA-N |
| XLogP | 5.21 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.76 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|