C41H44N4O — CID 134871565
3-[[5,6-bis(3,3-dimethylbut-1-ynyl)-3-methoxyisoindol-1-ylidene]amino]-5,6-bis(3,3-dimethylbut-1-ynyl)isoindol-1-imine (PubChem CID 134871565) has the molecular formula C41H44N4O and a molecular weight of 608.83 g/mol. Its IUPAC name is 3-[[5,6-bis(3,3-dimethylbut-1-ynyl)-3-methoxyisoindol-1-ylidene]amino]-5,6-bis(3,3-dimethylbut-1-ynyl)isoindol-1-imine.
| Compound Name | 3-[[5,6-bis(3,3-dimethylbut-1-ynyl)-3-methoxyisoindol-1-ylidene]amino]-5,6-bis(3,3-dimethylbut-1-ynyl)isoindol-1-imine |
|---|---|
| PubChem CID | 134871565 |
| Molecular Formula | C41H44N4O |
| Molecular Weight | 608.83 g/mol |
| Exact Mass | 608.35 |
| IUPAC Name | 3-[[5,6-bis(3,3-dimethylbut-1-ynyl)-3-methoxyisoindol-1-ylidene]amino]-5,6-bis(3,3-dimethylbut-1-ynyl)isoindol-1-imine |
| SMILES | [H]/N=C1\N=C(/N=C2\N=C(OC)c3cc(C#CC(C)(C)C)c(C#CC(C)(C)C)cc32)c2cc(C#CC(C)(C)C)c(C#CC(C)(C)C)cc21 |
| InChI | InChI=1S/C41H44N4O/c1-38(2,3)18-14-26-22-30-31(23-27(26)15-19-39(4,5)6)35(43-34(30)42)44-36-32-24-28(16-20-40(7,8)9)29(17-21-41(10,11)12)25-33(32)37(45-36)46-13/h22-25,42H,1-13H3/b42-34-,44-36- |
| InChIKey | ILDPNQFGAZFUGH-QRJMTNRESA-N |
| XLogP | 8.22 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.83 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|