C25H18N2O2 — CID 134871906
(5R,6R,9Z)-9-benzylidene-6,8-diphenyl-2-oxa-3,7-diazaspiro[4.4]nona-3,7-dien-1-one (PubChem CID 134871906) has the molecular formula C25H18N2O2 and a molecular weight of 378.43 g/mol. Its IUPAC name is (5R,6R,9Z)-9-benzylidene-6,8-diphenyl-2-oxa-3,7-diazaspiro[4.4]nona-3,7-dien-1-one.
| Compound Name | (5R,6R,9Z)-9-benzylidene-6,8-diphenyl-2-oxa-3,7-diazaspiro[4.4]nona-3,7-dien-1-one |
|---|---|
| PubChem CID | 134871906 |
| Molecular Formula | C25H18N2O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (5R,6R,9Z)-9-benzylidene-6,8-diphenyl-2-oxa-3,7-diazaspiro[4.4]nona-3,7-dien-1-one |
| SMILES | O=C1ON=C[C@]12/C(=C/c1ccccc1)C(c1ccccc1)=N[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C25H18N2O2/c28-24-25(17-26-29-24)21(16-18-10-4-1-5-11-18)22(19-12-6-2-7-13-19)27-23(25)20-14-8-3-9-15-20/h1-17,23H/b21-16+/t23-,25-/m1/s1 |
| InChIKey | ZKQYDZJJCDQUQR-OYQNOOMCSA-N |
| XLogP | 4.84 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|