C31H29NO2 — CID 164888114
methyl 3-(benzhydrylideneamino)-2,2-dimethyl-3-(4-phenylphenyl)propanoate (PubChem CID 164888114) has the molecular formula C31H29NO2 and a molecular weight of 447.58 g/mol. Its IUPAC name is methyl 3-(benzhydrylideneamino)-2,2-dimethyl-3-(4-phenylphenyl)propanoate.
| Compound Name | methyl 3-(benzhydrylideneamino)-2,2-dimethyl-3-(4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 164888114 |
| Molecular Formula | C31H29NO2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | methyl 3-(benzhydrylideneamino)-2,2-dimethyl-3-(4-phenylphenyl)propanoate |
| SMILES | COC(=O)C(C)(C)C(N=C(c1ccccc1)c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H29NO2/c1-31(2,30(33)34-3)29(27-21-19-24(20-22-27)23-13-7-4-8-14-23)32-28(25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-22,29H,1-3H3 |
| InChIKey | JZSKGKLFHVJADO-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|