C32H28F3NO2 — CID 162639856
methyl 2-(benzhydrylideneamino)-3-methyl-3-phenyl-2-[4-(trifluoromethyl)phenyl]butanoate (PubChem CID 162639856) has the molecular formula C32H28F3NO2 and a molecular weight of 515.58 g/mol. Its IUPAC name is methyl 2-(benzhydrylideneamino)-3-methyl-3-phenyl-2-[4-(trifluoromethyl)phenyl]butanoate.
| Compound Name | methyl 2-(benzhydrylideneamino)-3-methyl-3-phenyl-2-[4-(trifluoromethyl)phenyl]butanoate |
|---|---|
| PubChem CID | 162639856 |
| Molecular Formula | C32H28F3NO2 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | methyl 2-(benzhydrylideneamino)-3-methyl-3-phenyl-2-[4-(trifluoromethyl)phenyl]butanoate |
| SMILES | COC(=O)C(N=C(c1ccccc1)c1ccccc1)(c1ccc(C(F)(F)F)cc1)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C32H28F3NO2/c1-30(2,25-17-11-6-12-18-25)31(29(37)38-3,26-19-21-27(22-20-26)32(33,34)35)36-28(23-13-7-4-8-14-23)24-15-9-5-10-16-24/h4-22H,1-3H3 |
| InChIKey | ZZUYRYPCIHGQDC-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|