C20H18F3NO2 — CID 150297715
tert-butyl 2-[4-(trifluoromethyl)phenyl]indole-2-carboxylate (PubChem CID 150297715) has the molecular formula C20H18F3NO2 and a molecular weight of 361.36 g/mol. Its IUPAC name is tert-butyl 2-[4-(trifluoromethyl)phenyl]indole-2-carboxylate.
| Compound Name | tert-butyl 2-[4-(trifluoromethyl)phenyl]indole-2-carboxylate |
|---|---|
| PubChem CID | 150297715 |
| Molecular Formula | C20H18F3NO2 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | tert-butyl 2-[4-(trifluoromethyl)phenyl]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(c2ccc(C(F)(F)F)cc2)C=c2ccccc2=N1 |
| InChI | InChI=1S/C20H18F3NO2/c1-18(2,3)26-17(25)19(12-13-6-4-5-7-16(13)24-19)14-8-10-15(11-9-14)20(21,22)23/h4-12H,1-3H3 |
| InChIKey | GIXWVCNAPDCVCP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |