methyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate

C15H10F2N2O2 — CID 22482462

IUPACmethyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate
SMILESCOC(=O)C1(c2c(F)cccc2F)N=c2ccccc2=N1
InChIInChI=1S/C15H10F2N2O2/c1-21-14(20)15(13-9(16)5-4-6-10(13)17)18-11-7-2-3-8-12(11)19-15/h2-8H,1H3
InChIKeyMYWAWSNXWNDVCX-UHFFFAOYSA-N
MW288.25 g/mol
LogP1.24
Rot. Bonds2

About methyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate

methyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate (PubChem CID 22482462) has the molecular formula C15H10F2N2O2 and a molecular weight of 288.25 g/mol. Its IUPAC name is methyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate.

Molecular Properties

Compound Namemethyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate
PubChem CID22482462
Molecular FormulaC15H10F2N2O2
Molecular Weight288.25 g/mol
Exact Mass288.07
IUPAC Namemethyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate
SMILESCOC(=O)C1(c2c(F)cccc2F)N=c2ccccc2=N1
InChIInChI=1S/C15H10F2N2O2/c1-21-14(20)15(13-9(16)5-4-6-10(13)17)18-11-7-2-3-8-12(11)19-15/h2-8H,1H3
InChIKeyMYWAWSNXWNDVCX-UHFFFAOYSA-N
XLogP1.24
TPSA51.02 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.25
LogP ≤ 51.24
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate?
The IUPAC name of methyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate (CID 22482462) is methyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate.
What is the SMILES notation for methyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate?
The canonical SMILES for methyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate is COC(=O)C1(c2c(F)cccc2F)N=c2ccccc2=N1.
What is the InChIKey of methyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate?
The InChIKey is MYWAWSNXWNDVCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F2N2O2/c1-21-14(20)15(13-9(16)5-4-6-10(13)17)18-11-7-2-3-8-12(11)19-15/h2-8H,1H3.
What are the key properties of methyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate?
methyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate has a molecular weight of 288.25 g/mol, XLogP of 1.24, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,6-difluorophenyl)benzimidazole-2-carboxylate is sourced from PubChem (CID 22482462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).