C24H19F2NO3 — CID 166436606
ethyl (E,2R)-2-[(2,6-difluoro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]-2,4-diphenylbut-3-enoate (PubChem CID 166436606) has the molecular formula C24H19F2NO3 and a molecular weight of 407.42 g/mol. Its IUPAC name is ethyl (E,2R)-2-[(2,6-difluoro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]-2,4-diphenylbut-3-enoate.
| Compound Name | ethyl (E,2R)-2-[(2,6-difluoro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]-2,4-diphenylbut-3-enoate |
|---|---|
| PubChem CID | 166436606 |
| Molecular Formula | C24H19F2NO3 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | ethyl (E,2R)-2-[(2,6-difluoro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]-2,4-diphenylbut-3-enoate |
| SMILES | CCOC(=O)[C@](/C=C/c1ccccc1)(N=C1C(F)=CC(=O)C=C1F)c1ccccc1 |
| InChI | InChI=1S/C24H19F2NO3/c1-2-30-23(29)24(18-11-7-4-8-12-18,14-13-17-9-5-3-6-10-17)27-22-20(25)15-19(28)16-21(22)26/h3-16H,2H2,1H3/b14-13+/t24-/m1/s1 |
| InChIKey | QXRBPPIINGHUBW-XIQMRYHBSA-N |
| XLogP | 4.89 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|