C24H20F3NO2 — CID 164888032
methyl 3-(benzhydrylideneamino)-3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 164888032) has the molecular formula C24H20F3NO2 and a molecular weight of 411.42 g/mol. Its IUPAC name is methyl 3-(benzhydrylideneamino)-3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl 3-(benzhydrylideneamino)-3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 164888032 |
| Molecular Formula | C24H20F3NO2 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | methyl 3-(benzhydrylideneamino)-3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)CC(N=C(c1ccccc1)c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H20F3NO2/c1-30-22(29)16-21(17-12-14-20(15-13-17)24(25,26)27)28-23(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,21H,16H2,1H3 |
| InChIKey | FLUAOWXUSXSGJF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|